C12H12Cl2N2OS2 — CID 4145582
N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]pentanamide (PubChem CID 4145582) has the molecular formula C12H12Cl2N2OS2 and a molecular weight of 335.28 g/mol. Its IUPAC name is N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]pentanamide.
| Compound Name | N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 4145582 |
| Molecular Formula | C12H12Cl2N2OS2 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1nc(-c2cc(Cl)sc2Cl)cs1 |
| InChI | InChI=1S/C12H12Cl2N2OS2/c1-2-3-4-10(17)16-12-15-8(6-18-12)7-5-9(13)19-11(7)14/h5-6H,2-4H2,1H3,(H,15,16,17) |
| InChIKey | YHAJWIAZQDSSTA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |