C17H16Cl2N4O3S2 — CID 55396462
N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide (PubChem CID 55396462) has the molecular formula C17H16Cl2N4O3S2 and a molecular weight of 459.38 g/mol. Its IUPAC name is N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide.
| Compound Name | N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide |
|---|---|
| PubChem CID | 55396462 |
| Molecular Formula | C17H16Cl2N4O3S2 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | N-[4-(2,5-dichlorothiophen-3-yl)-1,3-thiazol-2-yl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCC2)C1=O)Nc1nc(-c2cc(Cl)sc2Cl)cs1 |
| InChI | InChI=1S/C17H16Cl2N4O3S2/c18-11-7-9(13(19)28-11)10-8-27-15(20-10)21-12(24)3-6-23-14(25)17(22-16(23)26)4-1-2-5-17/h7-8H,1-6H2,(H,22,26)(H,20,21,24) |
| InChIKey | FPAKRKPALBBPHH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|