C22H26N4O3S — CID 41188908
2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 41188908) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 41188908 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)CN3C(=O)NC4(CCCCC4)C3=O)n2)cc1C |
| InChI | InChI=1S/C22H26N4O3S/c1-13-9-15(3)16(10-14(13)2)17-12-30-20(23-17)24-18(27)11-26-19(28)22(25-21(26)29)7-5-4-6-8-22/h9-10,12H,4-8,11H2,1-3H3,(H,25,29)(H,23,24,27) |
| InChIKey | LJPWLBVTWYVYNG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|