C14H13NO2S — CID 135513653
N-benzyl-2,4-dihydroxybenzenecarbothioamide (PubChem CID 135513653) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is N-benzyl-2,4-dihydroxybenzenecarbothioamide.
| Compound Name | N-benzyl-2,4-dihydroxybenzenecarbothioamide |
|---|---|
| PubChem CID | 135513653 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | N-benzyl-2,4-dihydroxybenzenecarbothioamide |
| SMILES | Oc1ccc(C(=S)NCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C14H13NO2S/c16-11-6-7-12(13(17)8-11)14(18)15-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2,(H,15,18) |
| InChIKey | PWPXPTIOAMRMAZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|