C15H13NO4S — CID 135439509
methyl 2-[(2,4-dihydroxybenzenecarbothioyl)amino]benzoate (PubChem CID 135439509) has the molecular formula C15H13NO4S and a molecular weight of 303.34 g/mol. Its IUPAC name is methyl 2-[(2,4-dihydroxybenzenecarbothioyl)amino]benzoate.
| Compound Name | methyl 2-[(2,4-dihydroxybenzenecarbothioyl)amino]benzoate |
|---|---|
| PubChem CID | 135439509 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | methyl 2-[(2,4-dihydroxybenzenecarbothioyl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)c1ccc(O)cc1O |
| InChI | InChI=1S/C15H13NO4S/c1-20-15(19)10-4-2-3-5-12(10)16-14(21)11-7-6-9(17)8-13(11)18/h2-8,17-18H,1H3,(H,16,21) |
| InChIKey | YGDZSHSKLPIIBJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|