C13H9F2NO2S — CID 135433828
N-(2,4-difluorophenyl)-2,4-dihydroxybenzenecarbothioamide (PubChem CID 135433828) has the molecular formula C13H9F2NO2S and a molecular weight of 281.28 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2,4-dihydroxybenzenecarbothioamide.
| Compound Name | N-(2,4-difluorophenyl)-2,4-dihydroxybenzenecarbothioamide |
|---|---|
| PubChem CID | 135433828 |
| Molecular Formula | C13H9F2NO2S |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | N-(2,4-difluorophenyl)-2,4-dihydroxybenzenecarbothioamide |
| SMILES | Oc1ccc(C(=S)Nc2ccc(F)cc2F)c(O)c1 |
| InChI | InChI=1S/C13H9F2NO2S/c14-7-1-4-11(10(15)5-7)16-13(19)9-3-2-8(17)6-12(9)18/h1-6,17-18H,(H,16,19) |
| InChIKey | YSPCXGBUPKQHJQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|