C13H10N2O5S — CID 135513869
2,4-dihydroxy-N-(2-hydroxy-4-nitrophenyl)benzenecarbothioamide (PubChem CID 135513869) has the molecular formula C13H10N2O5S and a molecular weight of 306.30 g/mol. Its IUPAC name is 2,4-dihydroxy-N-(2-hydroxy-4-nitrophenyl)benzenecarbothioamide.
| Compound Name | 2,4-dihydroxy-N-(2-hydroxy-4-nitrophenyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 135513869 |
| Molecular Formula | C13H10N2O5S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2,4-dihydroxy-N-(2-hydroxy-4-nitrophenyl)benzenecarbothioamide |
| SMILES | O=[N+]([O-])c1ccc(NC(=S)c2ccc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C13H10N2O5S/c16-8-2-3-9(11(17)6-8)13(21)14-10-4-1-7(15(19)20)5-12(10)18/h1-6,16-18H,(H,14,21) |
| InChIKey | FCSVYVZPQGWGJR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|