C14H14N2O3 — CID 69011055
1-benzyl-3-(2,4-dihydroxyphenyl)urea (PubChem CID 69011055) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 1-benzyl-3-(2,4-dihydroxyphenyl)urea.
| Compound Name | 1-benzyl-3-(2,4-dihydroxyphenyl)urea |
|---|---|
| PubChem CID | 69011055 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-benzyl-3-(2,4-dihydroxyphenyl)urea |
| SMILES | O=C(NCc1ccccc1)Nc1ccc(O)cc1O |
| InChI | InChI=1S/C14H14N2O3/c17-11-6-7-12(13(18)8-11)16-14(19)15-9-10-4-2-1-3-5-10/h1-8,17-18H,9H2,(H2,15,16,19) |
| InChIKey | VWYXJDVWHMYJTM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|