C18H20N2O5 — CID 69009769
ethyl 2-[(2,4-dihydroxyphenyl)carbamoylamino]-3-phenylpropanoate (PubChem CID 69009769) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is ethyl 2-[(2,4-dihydroxyphenyl)carbamoylamino]-3-phenylpropanoate.
| Compound Name | ethyl 2-[(2,4-dihydroxyphenyl)carbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 69009769 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | ethyl 2-[(2,4-dihydroxyphenyl)carbamoylamino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)NC(=O)Nc1ccc(O)cc1O |
| InChI | InChI=1S/C18H20N2O5/c1-2-25-17(23)15(10-12-6-4-3-5-7-12)20-18(24)19-14-9-8-13(21)11-16(14)22/h3-9,11,15,21-22H,2,10H2,1H3,(H2,19,20,24) |
| InChIKey | SKPAHILNKDXWSG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|