C19H28N2O4 — CID 47704268
4-[2-(diethylcarbamoyl)anilino]-2,2-diethyl-4-oxobutanoic acid (PubChem CID 47704268) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 4-[2-(diethylcarbamoyl)anilino]-2,2-diethyl-4-oxobutanoic acid.
| Compound Name | 4-[2-(diethylcarbamoyl)anilino]-2,2-diethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 47704268 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 4-[2-(diethylcarbamoyl)anilino]-2,2-diethyl-4-oxobutanoic acid |
| SMILES | CCN(CC)C(=O)c1ccccc1NC(=O)CC(CC)(CC)C(=O)O |
| InChI | InChI=1S/C19H28N2O4/c1-5-19(6-2,18(24)25)13-16(22)20-15-12-10-9-11-14(15)17(23)21(7-3)8-4/h9-12H,5-8,13H2,1-4H3,(H,20,22)(H,24,25) |
| InChIKey | TYGYNLDVGVTJGW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |