C17H26N2O3 — CID 86835537
N,N-diethyl-2-(3-propan-2-yloxypropanoylamino)benzamide (PubChem CID 86835537) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is N,N-diethyl-2-(3-propan-2-yloxypropanoylamino)benzamide.
| Compound Name | N,N-diethyl-2-(3-propan-2-yloxypropanoylamino)benzamide |
|---|---|
| PubChem CID | 86835537 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N,N-diethyl-2-(3-propan-2-yloxypropanoylamino)benzamide |
| SMILES | CCN(CC)C(=O)c1ccccc1NC(=O)CCOC(C)C |
| InChI | InChI=1S/C17H26N2O3/c1-5-19(6-2)17(21)14-9-7-8-10-15(14)18-16(20)11-12-22-13(3)4/h7-10,13H,5-6,11-12H2,1-4H3,(H,18,20) |
| InChIKey | SKVGAAAIPSCCEJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |