C20H23FN2O2S — CID 86835480
N,N-diethyl-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]benzamide (PubChem CID 86835480) has the molecular formula C20H23FN2O2S and a molecular weight of 374.48 g/mol. Its IUPAC name is N,N-diethyl-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]benzamide.
| Compound Name | N,N-diethyl-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]benzamide |
|---|---|
| PubChem CID | 86835480 |
| Molecular Formula | C20H23FN2O2S |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N,N-diethyl-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccccc1NC(=O)CCSc1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN2O2S/c1-3-23(4-2)20(25)17-7-5-6-8-18(17)22-19(24)13-14-26-16-11-9-15(21)10-12-16/h5-12H,3-4,13-14H2,1-2H3,(H,22,24) |
| InChIKey | CVMJGUFRNQNQHZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |