C16H8N4O2S — CID 168610005
4-thiophen-3-yl-2-(1,2,2-tricyanoethenylamino)benzoic acid (PubChem CID 168610005) has the molecular formula C16H8N4O2S and a molecular weight of 320.33 g/mol. Its IUPAC name is 4-thiophen-3-yl-2-(1,2,2-tricyanoethenylamino)benzoic acid.
| Compound Name | 4-thiophen-3-yl-2-(1,2,2-tricyanoethenylamino)benzoic acid |
|---|---|
| PubChem CID | 168610005 |
| Molecular Formula | C16H8N4O2S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 4-thiophen-3-yl-2-(1,2,2-tricyanoethenylamino)benzoic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(-c2ccsc2)ccc1C(=O)O |
| InChI | InChI=1S/C16H8N4O2S/c17-6-12(7-18)15(8-19)20-14-5-10(11-3-4-23-9-11)1-2-13(14)16(21)22/h1-5,9,20H,(H,21,22) |
| InChIKey | DZDVACIKQWYQQJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|