C12H6ClN5O — CID 168610806
5-chloro-2-(1,2,2-tricyanoethenylamino)benzamide (PubChem CID 168610806) has the molecular formula C12H6ClN5O and a molecular weight of 271.67 g/mol. Its IUPAC name is 5-chloro-2-(1,2,2-tricyanoethenylamino)benzamide.
| Compound Name | 5-chloro-2-(1,2,2-tricyanoethenylamino)benzamide |
|---|---|
| PubChem CID | 168610806 |
| Molecular Formula | C12H6ClN5O |
| Molecular Weight | 271.67 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 5-chloro-2-(1,2,2-tricyanoethenylamino)benzamide |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(Cl)cc1C(N)=O |
| InChI | InChI=1S/C12H6ClN5O/c13-8-1-2-10(9(3-8)12(17)19)18-11(6-16)7(4-14)5-15/h1-3,18H,(H2,17,19) |
| InChIKey | MLNUQQHVNPJQBL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.67 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|