C14H9BrN4O2 — CID 168610244
methyl 5-bromo-4-methyl-2-(1,2,2-tricyanoethenylamino)benzoate (PubChem CID 168610244) has the molecular formula C14H9BrN4O2 and a molecular weight of 345.16 g/mol. Its IUPAC name is methyl 5-bromo-4-methyl-2-(1,2,2-tricyanoethenylamino)benzoate.
| Compound Name | methyl 5-bromo-4-methyl-2-(1,2,2-tricyanoethenylamino)benzoate |
|---|---|
| PubChem CID | 168610244 |
| Molecular Formula | C14H9BrN4O2 |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | methyl 5-bromo-4-methyl-2-(1,2,2-tricyanoethenylamino)benzoate |
| SMILES | COC(=O)c1cc(Br)c(C)cc1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C14H9BrN4O2/c1-8-3-12(10(4-11(8)15)14(20)21-2)19-13(7-18)9(5-16)6-17/h3-4,19H,1-2H3 |
| InChIKey | RNTJGDLCOZPNFO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|