C11H11Br2NO2 — CID 169189607
1-bromo-N-(5-bromo-2-hydroxyphenyl)cyclobutane-1-carboxamide (PubChem CID 169189607) has the molecular formula C11H11Br2NO2 and a molecular weight of 349.02 g/mol. Its IUPAC name is 1-bromo-N-(5-bromo-2-hydroxyphenyl)cyclobutane-1-carboxamide.
| Compound Name | 1-bromo-N-(5-bromo-2-hydroxyphenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 169189607 |
| Molecular Formula | C11H11Br2NO2 |
| Molecular Weight | 349.02 g/mol |
| Exact Mass | 346.92 |
| IUPAC Name | 1-bromo-N-(5-bromo-2-hydroxyphenyl)cyclobutane-1-carboxamide |
| SMILES | O=C(Nc1cc(Br)ccc1O)C1(Br)CCC1 |
| InChI | InChI=1S/C11H11Br2NO2/c12-7-2-3-9(15)8(6-7)14-10(16)11(13)4-1-5-11/h2-3,6,15H,1,4-5H2,(H,14,16) |
| InChIKey | HOHWSJMYPBEFIY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.02 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|