C10H13BrN2O3 — CID 167793824
4-amino-N-(5-bromo-2-hydroxyphenyl)-3-hydroxybutanamide (PubChem CID 167793824) has the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. Its IUPAC name is 4-amino-N-(5-bromo-2-hydroxyphenyl)-3-hydroxybutanamide.
| Compound Name | 4-amino-N-(5-bromo-2-hydroxyphenyl)-3-hydroxybutanamide |
|---|---|
| PubChem CID | 167793824 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 4-amino-N-(5-bromo-2-hydroxyphenyl)-3-hydroxybutanamide |
| SMILES | NCC(O)CC(=O)Nc1cc(Br)ccc1O |
| InChI | InChI=1S/C10H13BrN2O3/c11-6-1-2-9(15)8(3-6)13-10(16)4-7(14)5-12/h1-3,7,14-15H,4-5,12H2,(H,13,16) |
| InChIKey | MGYXOLVUWIESNW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|