About (2,4-dibromophenyl)boronic acid
(2,4-dibromophenyl)boronic acid (PubChem CID 90419202) has the molecular formula C6H5BBr2O2
and a molecular weight of 279.72 g/mol. Its IUPAC name is (2,4-dibromophenyl)boronic acid.
Molecular Properties
| Compound Name | (2,4-dibromophenyl)boronic acid |
| PubChem CID | 90419202 |
| Molecular Formula | C6H5BBr2O2 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 277.87 |
| IUPAC Name | (2,4-dibromophenyl)boronic acid |
| SMILES | OB(O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C6H5BBr2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
| InChIKey | VWCZANMQOQOJTE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dibromophenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dibromophenyl)boronic acid?
The IUPAC name of (2,4-dibromophenyl)boronic acid (CID 90419202) is (2,4-dibromophenyl)boronic acid.
What is the SMILES notation for (2,4-dibromophenyl)boronic acid?
The canonical SMILES for (2,4-dibromophenyl)boronic acid is OB(O)c1ccc(Br)cc1Br.
What is the InChIKey of (2,4-dibromophenyl)boronic acid?
The InChIKey is VWCZANMQOQOJTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BBr2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H.
What are the key properties of (2,4-dibromophenyl)boronic acid?
(2,4-dibromophenyl)boronic acid has a molecular weight of 279.72 g/mol, XLogP of 0.89, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dibromophenyl)boronic acid is sourced from PubChem (CID 90419202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).