About 1,3-dibromobenzene
1,3-dibromobenzene (PubChem CID 7927) has the molecular formula C6H4Br2
and a molecular weight of 235.91 g/mol. Its IUPAC name is 1,3-dibromobenzene.
Molecular Properties
| Compound Name | 1,3-dibromobenzene |
| PubChem CID | 7927 |
| Molecular Formula | C6H4Br2 |
| Molecular Weight | 235.91 g/mol |
| Exact Mass | 233.87 |
| IUPAC Name | 1,3-dibromobenzene |
| SMILES | Brc1cccc(Br)c1 |
| InChI | InChI=1S/C6H4Br2/c7-5-2-1-3-6(8)4-5/h1-4H |
| InChIKey | JSRLURSZEMLAFO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.91 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-dibromobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromobenzene?
The IUPAC name of 1,3-dibromobenzene (CID 7927) is 1,3-dibromobenzene.
What is the SMILES notation for 1,3-dibromobenzene?
The canonical SMILES for 1,3-dibromobenzene is Brc1cccc(Br)c1.
What is the InChIKey of 1,3-dibromobenzene?
The InChIKey is JSRLURSZEMLAFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Br2/c7-5-2-1-3-6(8)4-5/h1-4H.
What are the key properties of 1,3-dibromobenzene?
1,3-dibromobenzene has a molecular weight of 235.91 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromobenzene is sourced from PubChem (CID 7927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).