About 2-bromobenzene-1,4-diol;but-2-ene
2-bromobenzene-1,4-diol;but-2-ene (PubChem CID 159611901) has the molecular formula C10H13BrO2
and a molecular weight of 245.12 g/mol. Its IUPAC name is 2-bromobenzene-1,4-diol;but-2-ene.
Molecular Properties
| Compound Name | 2-bromobenzene-1,4-diol;but-2-ene |
| PubChem CID | 159611901 |
| Molecular Formula | C10H13BrO2 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 2-bromobenzene-1,4-diol;but-2-ene |
| SMILES | CC=CC.Oc1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C6H5BrO2.C4H8/c7-5-3-4(8)1-2-6(5)9;1-3-4-2/h1-3,8-9H;3-4H,1-2H3 |
| InChIKey | MMULBFAQIWMSAC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromobenzene-1,4-diol;but-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobenzene-1,4-diol;but-2-ene?
The IUPAC name of 2-bromobenzene-1,4-diol;but-2-ene (CID 159611901) is 2-bromobenzene-1,4-diol;but-2-ene.
What is the SMILES notation for 2-bromobenzene-1,4-diol;but-2-ene?
The canonical SMILES for 2-bromobenzene-1,4-diol;but-2-ene is CC=CC.Oc1ccc(O)c(Br)c1.
What is the InChIKey of 2-bromobenzene-1,4-diol;but-2-ene?
The InChIKey is MMULBFAQIWMSAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrO2.C4H8/c7-5-3-4(8)1-2-6(5)9;1-3-4-2/h1-3,8-9H;3-4H,1-2H3.
What are the key properties of 2-bromobenzene-1,4-diol;but-2-ene?
2-bromobenzene-1,4-diol;but-2-ene has a molecular weight of 245.12 g/mol, XLogP of 3.44, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobenzene-1,4-diol;but-2-ene is sourced from PubChem (CID 159611901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).