About 3-bromophenol
3-bromophenol (PubChem CID 11563) has the molecular formula C6H5BrO
and a molecular weight of 173.01 g/mol. Its IUPAC name is 3-bromophenol.
Molecular Properties
| Compound Name | 3-bromophenol |
| PubChem CID | 11563 |
| Molecular Formula | C6H5BrO |
| Molecular Weight | 173.01 g/mol |
| Exact Mass | 171.95 |
| IUPAC Name | 3-bromophenol |
| SMILES | Oc1cccc(Br)c1 |
| InChI | InChI=1S/C6H5BrO/c7-5-2-1-3-6(8)4-5/h1-4,8H |
| InChIKey | MNOJRWOWILAHAV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.01 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromophenol?
The IUPAC name of 3-bromophenol (CID 11563) is 3-bromophenol.
What is the SMILES notation for 3-bromophenol?
The canonical SMILES for 3-bromophenol is Oc1cccc(Br)c1.
What is the InChIKey of 3-bromophenol?
The InChIKey is MNOJRWOWILAHAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrO/c7-5-2-1-3-6(8)4-5/h1-4,8H.
What are the key properties of 3-bromophenol?
3-bromophenol has a molecular weight of 173.01 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromophenol is sourced from PubChem (CID 11563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).