C11H20BrNO2 — CID 20502809
N-ethylethanamine;2-methylbenzene-1,4-diol;hydrobromide (PubChem CID 20502809) has the molecular formula C11H20BrNO2 and a molecular weight of 278.19 g/mol. Its IUPAC name is N-ethylethanamine;2-methylbenzene-1,4-diol;hydrobromide.
| Compound Name | N-ethylethanamine;2-methylbenzene-1,4-diol;hydrobromide |
|---|---|
| PubChem CID | 20502809 |
| Molecular Formula | C11H20BrNO2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-ethylethanamine;2-methylbenzene-1,4-diol;hydrobromide |
| SMILES | Br.CCNCC.Cc1cc(O)ccc1O |
| InChI | InChI=1S/C7H8O2.C4H11N.BrH/c1-5-4-6(8)2-3-7(5)9;1-3-5-4-2;/h2-4,8-9H,1H3;5H,3-4H2,1-2H3;1H |
| InChIKey | UCEMHHJACFSASD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|