About 1-heptoxy-2-iodobenzene
1-heptoxy-2-iodobenzene (PubChem CID 63530624) has the molecular formula C13H19IO
and a molecular weight of 318.20 g/mol. Its IUPAC name is 1-heptoxy-2-iodobenzene.
Molecular Properties
| Compound Name | 1-heptoxy-2-iodobenzene |
| PubChem CID | 63530624 |
| Molecular Formula | C13H19IO |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-heptoxy-2-iodobenzene |
| SMILES | CCCCCCCOc1ccccc1I |
| InChI | InChI=1S/C13H19IO/c1-2-3-4-5-8-11-15-13-10-7-6-9-12(13)14/h6-7,9-10H,2-5,8,11H2,1H3 |
| InChIKey | TZJWLQKWHPKRJA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-heptoxy-2-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptoxy-2-iodobenzene?
The IUPAC name of 1-heptoxy-2-iodobenzene (CID 63530624) is 1-heptoxy-2-iodobenzene.
What is the SMILES notation for 1-heptoxy-2-iodobenzene?
The canonical SMILES for 1-heptoxy-2-iodobenzene is CCCCCCCOc1ccccc1I.
What is the InChIKey of 1-heptoxy-2-iodobenzene?
The InChIKey is TZJWLQKWHPKRJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19IO/c1-2-3-4-5-8-11-15-13-10-7-6-9-12(13)14/h6-7,9-10H,2-5,8,11H2,1H3.
What are the key properties of 1-heptoxy-2-iodobenzene?
1-heptoxy-2-iodobenzene has a molecular weight of 318.20 g/mol, XLogP of 4.64, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptoxy-2-iodobenzene is sourced from PubChem (CID 63530624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).