About [3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate
[3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate (PubChem CID 18083077) has the molecular formula C15H14N4O4S
and a molecular weight of 346.37 g/mol. Its IUPAC name is [3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate.
Molecular Properties
| Compound Name | [3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate |
| PubChem CID | 18083077 |
| Molecular Formula | C15H14N4O4S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | [3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate |
| SMILES | CCOc1ccc(S(=O)(=O)Oc2cccc(-n3cnnn3)c2)cc1 |
| InChI | InChI=1S/C15H14N4O4S/c1-2-22-13-6-8-15(9-7-13)24(20,21)23-14-5-3-4-12(10-14)19-11-16-17-18-19/h3-11H,2H2,1H3 |
| InChIKey | AJSOBWKOCBUACD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate?
The IUPAC name of [3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate (CID 18083077) is [3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate.
What is the SMILES notation for [3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate?
The canonical SMILES for [3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate is CCOc1ccc(S(=O)(=O)Oc2cccc(-n3cnnn3)c2)cc1.
What is the InChIKey of [3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate?
The InChIKey is AJSOBWKOCBUACD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O4S/c1-2-22-13-6-8-15(9-7-13)24(20,21)23-14-5-3-4-12(10-14)19-11-16-17-18-19/h3-11H,2H2,1H3.
What are the key properties of [3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate?
[3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate has a molecular weight of 346.37 g/mol, XLogP of 1.83, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(tetrazol-1-yl)phenyl] 4-ethoxybenzenesulfonate is sourced from PubChem (CID 18083077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).