C11H6Cl2N4O3S2 — CID 39793351
[3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate (PubChem CID 39793351) has the molecular formula C11H6Cl2N4O3S2 and a molecular weight of 377.23 g/mol. Its IUPAC name is [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate.
| Compound Name | [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate |
|---|---|
| PubChem CID | 39793351 |
| Molecular Formula | C11H6Cl2N4O3S2 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 375.93 |
| IUPAC Name | [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate |
| SMILES | O=S(=O)(Oc1cccc(-n2cnnn2)c1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H6Cl2N4O3S2/c12-10-5-9(11(13)21-10)22(18,19)20-8-3-1-2-7(4-8)17-6-14-15-16-17/h1-6H |
| InChIKey | BHGIDVQZVCRZTE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|