[3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate

C11H6Cl2N4O3S2 — CID 39793351

IUPAC[3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate
SMILESO=S(=O)(Oc1cccc(-n2cnnn2)c1)c1cc(Cl)sc1Cl
InChIInChI=1S/C11H6Cl2N4O3S2/c12-10-5-9(11(13)21-10)22(18,19)20-8-3-1-2-7(4-8)17-6-14-15-16-17/h1-6H
InChIKeyBHGIDVQZVCRZTE-UHFFFAOYSA-N
MW377.23 g/mol
LogP2.80
Rot. Bonds4

About [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate

[3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate (PubChem CID 39793351) has the molecular formula C11H6Cl2N4O3S2 and a molecular weight of 377.23 g/mol. Its IUPAC name is [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate.

Molecular Properties

Compound Name[3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate
PubChem CID39793351
Molecular FormulaC11H6Cl2N4O3S2
Molecular Weight377.23 g/mol
Exact Mass375.93
IUPAC Name[3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate
SMILESO=S(=O)(Oc1cccc(-n2cnnn2)c1)c1cc(Cl)sc1Cl
InChIInChI=1S/C11H6Cl2N4O3S2/c12-10-5-9(11(13)21-10)22(18,19)20-8-3-1-2-7(4-8)17-6-14-15-16-17/h1-6H
InChIKeyBHGIDVQZVCRZTE-UHFFFAOYSA-N
XLogP2.80
TPSA86.97 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500377.23
LogP ≤ 52.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}

Analyze [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate?
The IUPAC name of [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate (CID 39793351) is [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate.
What is the SMILES notation for [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate?
The canonical SMILES for [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate is O=S(=O)(Oc1cccc(-n2cnnn2)c1)c1cc(Cl)sc1Cl.
What is the InChIKey of [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate?
The InChIKey is BHGIDVQZVCRZTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Cl2N4O3S2/c12-10-5-9(11(13)21-10)22(18,19)20-8-3-1-2-7(4-8)17-6-14-15-16-17/h1-6H.
What are the key properties of [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate?
[3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate has a molecular weight of 377.23 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(tetrazol-1-yl)phenyl] 2,5-dichlorothiophene-3-sulfonate is sourced from PubChem (CID 39793351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).