C13H9Cl2N5O2S — CID 8519287
2,3-dichloro-N-[3-(tetrazol-1-yl)phenyl]benzenesulfonamide (PubChem CID 8519287) has the molecular formula C13H9Cl2N5O2S and a molecular weight of 370.22 g/mol. Its IUPAC name is 2,3-dichloro-N-[3-(tetrazol-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[3-(tetrazol-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8519287 |
| Molecular Formula | C13H9Cl2N5O2S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 2,3-dichloro-N-[3-(tetrazol-1-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-n2cnnn2)c1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H9Cl2N5O2S/c14-11-5-2-6-12(13(11)15)23(21,22)17-9-3-1-4-10(7-9)20-8-16-18-19-20/h1-8,17H |
| InChIKey | GTQBGUTWVBSEIY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |