C14H15NO6S2 — CID 31066756
(4-ethoxyphenyl) 3-sulfamoylbenzenesulfonate (PubChem CID 31066756) has the molecular formula C14H15NO6S2 and a molecular weight of 357.41 g/mol. Its IUPAC name is (4-ethoxyphenyl) 3-sulfamoylbenzenesulfonate.
| Compound Name | (4-ethoxyphenyl) 3-sulfamoylbenzenesulfonate |
|---|---|
| PubChem CID | 31066756 |
| Molecular Formula | C14H15NO6S2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | (4-ethoxyphenyl) 3-sulfamoylbenzenesulfonate |
| SMILES | CCOc1ccc(OS(=O)(=O)c2cccc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C14H15NO6S2/c1-2-20-11-6-8-12(9-7-11)21-23(18,19)14-5-3-4-13(10-14)22(15,16)17/h3-10H,2H2,1H3,(H2,15,16,17) |
| InChIKey | CJKOUPNMHWBNRA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|