C18H24N2O3S — CID 154762748
N-(1-amino-2-cyclopropylpropan-2-yl)-4-ethoxynaphthalene-1-sulfonamide (PubChem CID 154762748) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-4-ethoxynaphthalene-1-sulfonamide.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-4-ethoxynaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 154762748 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-4-ethoxynaphthalene-1-sulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC(C)(CN)C2CC2)c2ccccc12 |
| InChI | InChI=1S/C18H24N2O3S/c1-3-23-16-10-11-17(15-7-5-4-6-14(15)16)24(21,22)20-18(2,12-19)13-8-9-13/h4-7,10-11,13,20H,3,8-9,12,19H2,1-2H3 |
| InChIKey | TVFFCKQSHLGYTI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |