About (2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine
(2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine (PubChem CID 748027) has the molecular formula C19H25NO3S
and a molecular weight of 347.48 g/mol. Its IUPAC name is (2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine.
Molecular Properties
| Compound Name | (2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine |
| PubChem CID | 748027 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine |
| SMILES | CCOc1ccc(S(=O)(=O)N2[C@@H](C)CCC[C@@H]2C)c2ccccc12 |
| InChI | InChI=1S/C19H25NO3S/c1-4-23-18-12-13-19(17-11-6-5-10-16(17)18)24(21,22)20-14(2)8-7-9-15(20)3/h5-6,10-15H,4,7-9H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | WIEMMWUTFXAPGM-GJZGRUSLSA-N |
| XLogP | 4.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine?
The IUPAC name of (2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine (CID 748027) is (2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine.
What is the SMILES notation for (2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine?
The canonical SMILES for (2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine is CCOc1ccc(S(=O)(=O)N2[C@@H](C)CCC[C@@H]2C)c2ccccc12.
What is the InChIKey of (2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine?
The InChIKey is WIEMMWUTFXAPGM-GJZGRUSLSA-N. The full InChI is InChI=1S/C19H25NO3S/c1-4-23-18-12-13-19(17-11-6-5-10-16(17)18)24(21,22)20-14(2)8-7-9-15(20)3/h5-6,10-15H,4,7-9H2,1-3H3/t14-,15-/m0/s1.
What are the key properties of (2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine?
(2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine has a molecular weight of 347.48 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6S)-1-(4-ethoxynaphthalen-1-yl)sulfonyl-2,6-dimethylpiperidine is sourced from PubChem (CID 748027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).