C19H27ClN2O3S — CID 119975042
1-[1-(4-ethoxynaphthalen-1-yl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride (PubChem CID 119975042) has the molecular formula C19H27ClN2O3S and a molecular weight of 398.96 g/mol. Its IUPAC name is 1-[1-(4-ethoxynaphthalen-1-yl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-(4-ethoxynaphthalen-1-yl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119975042 |
| Molecular Formula | C19H27ClN2O3S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[1-(4-ethoxynaphthalen-1-yl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(C(C)N)CC2)c2ccccc12.Cl |
| InChI | InChI=1S/C19H26N2O3S.ClH/c1-3-24-18-8-9-19(17-7-5-4-6-16(17)18)25(22,23)21-12-10-15(11-13-21)14(2)20;/h4-9,14-15H,3,10-13,20H2,1-2H3;1H |
| InChIKey | CFNFGQOVDYSGIT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |