C17H23ClN2O3S — CID 119988979
[1-(4-ethoxynaphthalen-1-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 119988979) has the molecular formula C17H23ClN2O3S and a molecular weight of 370.90 g/mol. Its IUPAC name is [1-(4-ethoxynaphthalen-1-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(4-ethoxynaphthalen-1-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119988979 |
| Molecular Formula | C17H23ClN2O3S |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [1-(4-ethoxynaphthalen-1-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCCC2CN)c2ccccc12.Cl |
| InChI | InChI=1S/C17H22N2O3S.ClH/c1-2-22-16-9-10-17(15-8-4-3-7-14(15)16)23(20,21)19-11-5-6-13(19)12-18;/h3-4,7-10,13H,2,5-6,11-12,18H2,1H3;1H |
| InChIKey | YFZWFTVMKFSPLV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |