C25H30N2O3S — CID 91669820
1-(4-ethoxynaphthalen-1-yl)sulfonyl-4-(2,4,6-trimethylphenyl)piperazine (PubChem CID 91669820) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is 1-(4-ethoxynaphthalen-1-yl)sulfonyl-4-(2,4,6-trimethylphenyl)piperazine.
| Compound Name | 1-(4-ethoxynaphthalen-1-yl)sulfonyl-4-(2,4,6-trimethylphenyl)piperazine |
|---|---|
| PubChem CID | 91669820 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 1-(4-ethoxynaphthalen-1-yl)sulfonyl-4-(2,4,6-trimethylphenyl)piperazine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(c3c(C)cc(C)cc3C)CC2)c2ccccc12 |
| InChI | InChI=1S/C25H30N2O3S/c1-5-30-23-10-11-24(22-9-7-6-8-21(22)23)31(28,29)27-14-12-26(13-15-27)25-19(3)16-18(2)17-20(25)4/h6-11,16-17H,5,12-15H2,1-4H3 |
| InChIKey | GRTPMHPKFCVGNC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |