C13H10Cl2INO3 — CID 83223938
ethyl 2-(2,5-dichloro-7-iodoquinolin-8-yl)oxyacetate (PubChem CID 83223938) has the molecular formula C13H10Cl2INO3 and a molecular weight of 426.04 g/mol. Its IUPAC name is ethyl 2-(2,5-dichloro-7-iodoquinolin-8-yl)oxyacetate.
| Compound Name | ethyl 2-(2,5-dichloro-7-iodoquinolin-8-yl)oxyacetate |
|---|---|
| PubChem CID | 83223938 |
| Molecular Formula | C13H10Cl2INO3 |
| Molecular Weight | 426.04 g/mol |
| Exact Mass | 424.91 |
| IUPAC Name | ethyl 2-(2,5-dichloro-7-iodoquinolin-8-yl)oxyacetate |
| SMILES | CCOC(=O)COc1c(I)cc(Cl)c2ccc(Cl)nc12 |
| InChI | InChI=1S/C13H10Cl2INO3/c1-2-19-11(18)6-20-13-9(16)5-8(14)7-3-4-10(15)17-12(7)13/h3-5H,2,6H2,1H3 |
| InChIKey | YKWQIOGNSXJOTH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.04 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|