C17H27N3O3 — CID 67571411
N-(2,2-diaminoacetyl)-4-hydroxy-N-octylbenzamide (PubChem CID 67571411) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-(2,2-diaminoacetyl)-4-hydroxy-N-octylbenzamide.
| Compound Name | N-(2,2-diaminoacetyl)-4-hydroxy-N-octylbenzamide |
|---|---|
| PubChem CID | 67571411 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | N-(2,2-diaminoacetyl)-4-hydroxy-N-octylbenzamide |
| SMILES | CCCCCCCCN(C(=O)c1ccc(O)cc1)C(=O)C(N)N |
| InChI | InChI=1S/C17H27N3O3/c1-2-3-4-5-6-7-12-20(17(23)15(18)19)16(22)13-8-10-14(21)11-9-13/h8-11,15,21H,2-7,12,18-19H2,1H3 |
| InChIKey | FWJBWPXEQPCBKT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|