C17H28N4O3 — CID 67572338
N-(2,2-diaminoacetyl)-4-hydroxy-N'-octylbenzohydrazide (PubChem CID 67572338) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-(2,2-diaminoacetyl)-4-hydroxy-N'-octylbenzohydrazide.
| Compound Name | N-(2,2-diaminoacetyl)-4-hydroxy-N'-octylbenzohydrazide |
|---|---|
| PubChem CID | 67572338 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-(2,2-diaminoacetyl)-4-hydroxy-N'-octylbenzohydrazide |
| SMILES | CCCCCCCCNN(C(=O)c1ccc(O)cc1)C(=O)C(N)N |
| InChI | InChI=1S/C17H28N4O3/c1-2-3-4-5-6-7-12-20-21(17(24)15(18)19)16(23)13-8-10-14(22)11-9-13/h8-11,15,20,22H,2-7,12,18-19H2,1H3 |
| InChIKey | AVEXRMMUJPIRRX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|