C20H31N5S4 — CID 89363296
[butyl(3,3,3-tricyanopropyl)carbamothioyl]sulfanyl N,N-dibutylcarbamodithioate (PubChem CID 89363296) has the molecular formula C20H31N5S4 and a molecular weight of 469.77 g/mol. Its IUPAC name is [butyl(3,3,3-tricyanopropyl)carbamothioyl]sulfanyl N,N-dibutylcarbamodithioate.
| Compound Name | [butyl(3,3,3-tricyanopropyl)carbamothioyl]sulfanyl N,N-dibutylcarbamodithioate |
|---|---|
| PubChem CID | 89363296 |
| Molecular Formula | C20H31N5S4 |
| Molecular Weight | 469.77 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | [butyl(3,3,3-tricyanopropyl)carbamothioyl]sulfanyl N,N-dibutylcarbamodithioate |
| SMILES | CCCCN(CCCC)C(=S)SSC(=S)N(CCCC)CCC(C#N)(C#N)C#N |
| InChI | InChI=1S/C20H31N5S4/c1-4-7-11-24(12-8-5-2)18(26)28-29-19(27)25(13-9-6-3)14-10-20(15-21,16-22)17-23/h4-14H2,1-3H3 |
| InChIKey | CCYYIRRLHYJNIM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.77 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|