About dibutylcarbamodithioic acid;propanenitrile
dibutylcarbamodithioic acid;propanenitrile (PubChem CID 174759598) has the molecular formula C12H24N2S2
and a molecular weight of 260.47 g/mol. Its IUPAC name is dibutylcarbamodithioic acid;propanenitrile.
Molecular Properties
| Compound Name | dibutylcarbamodithioic acid;propanenitrile |
| PubChem CID | 174759598 |
| Molecular Formula | C12H24N2S2 |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | dibutylcarbamodithioic acid;propanenitrile |
| SMILES | CCC#N.CCCCN(CCCC)C(=S)S |
| InChI | InChI=1S/C9H19NS2.C3H5N/c1-3-5-7-10(9(11)12)8-6-4-2;1-2-3-4/h3-8H2,1-2H3,(H,11,12);2H2,1H3 |
| InChIKey | DCYNHUFIQRTVPQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 27.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dibutylcarbamodithioic acid;propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutylcarbamodithioic acid;propanenitrile?
The IUPAC name of dibutylcarbamodithioic acid;propanenitrile (CID 174759598) is dibutylcarbamodithioic acid;propanenitrile.
What is the SMILES notation for dibutylcarbamodithioic acid;propanenitrile?
The canonical SMILES for dibutylcarbamodithioic acid;propanenitrile is CCC#N.CCCCN(CCCC)C(=S)S.
What is the InChIKey of dibutylcarbamodithioic acid;propanenitrile?
The InChIKey is DCYNHUFIQRTVPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NS2.C3H5N/c1-3-5-7-10(9(11)12)8-6-4-2;1-2-3-4/h3-8H2,1-2H3,(H,11,12);2H2,1H3.
What are the key properties of dibutylcarbamodithioic acid;propanenitrile?
dibutylcarbamodithioic acid;propanenitrile has a molecular weight of 260.47 g/mol, XLogP of 4.02, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibutylcarbamodithioic acid;propanenitrile is sourced from PubChem (CID 174759598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).