C8H16N2S4 — CID 12812902
butyl-[2-(dithiocarboxyamino)ethyl]carbamodithioic acid (PubChem CID 12812902) has the molecular formula C8H16N2S4 and a molecular weight of 268.50 g/mol. Its IUPAC name is butyl-[2-(dithiocarboxyamino)ethyl]carbamodithioic acid.
| Compound Name | butyl-[2-(dithiocarboxyamino)ethyl]carbamodithioic acid |
|---|---|
| PubChem CID | 12812902 |
| Molecular Formula | C8H16N2S4 |
| Molecular Weight | 268.50 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | butyl-[2-(dithiocarboxyamino)ethyl]carbamodithioic acid |
| SMILES | CCCCN(CCNC(=S)S)C(=S)S |
| InChI | InChI=1S/C8H16N2S4/c1-2-3-5-10(8(13)14)6-4-9-7(11)12/h2-6H2,1H3,(H,13,14)(H2,9,11,12) |
| InChIKey | YORFIYHXKZUERA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|