C11H23CuN3S6 — CID 157112774
copper;dipropylcarbamodithioic acid;2-(dithiocarboxyamino)ethylcarbamodithioic acid (PubChem CID 157112774) has the molecular formula C11H23CuN3S6 and a molecular weight of 453.27 g/mol. Its IUPAC name is copper;dipropylcarbamodithioic acid;2-(dithiocarboxyamino)ethylcarbamodithioic acid.
| Compound Name | copper;dipropylcarbamodithioic acid;2-(dithiocarboxyamino)ethylcarbamodithioic acid |
|---|---|
| PubChem CID | 157112774 |
| Molecular Formula | C11H23CuN3S6 |
| Molecular Weight | 453.27 g/mol |
| Exact Mass | 451.95 |
| IUPAC Name | copper;dipropylcarbamodithioic acid;2-(dithiocarboxyamino)ethylcarbamodithioic acid |
| SMILES | CCCN(CCC)C(=S)S.S=C(S)NCCNC(=S)S.[Cu] |
| InChI | InChI=1S/C7H15NS2.C4H8N2S4.Cu/c1-3-5-8(6-4-2)7(9)10;7-3(8)5-1-2-6-4(9)10;/h3-6H2,1-2H3,(H,9,10);1-2H2,(H2,5,7,8)(H2,6,9,10); |
| InChIKey | AHAVLKYXNDEAMD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|