About 10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride
10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride (PubChem CID 171509465) has the molecular formula C28H38BrClNP
and a molecular weight of 534.95 g/mol. Its IUPAC name is 10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride |
| PubChem CID | 171509465 |
| Molecular Formula | C28H38BrClNP |
| Molecular Weight | 534.95 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride |
| SMILES | Cl.NCCCCCCCCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H37BrNP.ClH/c29-31(26-18-10-7-11-19-26,27-20-12-8-13-21-27,28-22-14-9-15-23-28)25-17-6-4-2-1-3-5-16-24-30;/h7-15,18-23H,1-6,16-17,24-25,30H2;1H |
| InChIKey | BXFFSTLUGLSRAY-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.95 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride?
The IUPAC name of 10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride (CID 171509465) is 10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride.
What is the SMILES notation for 10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride?
The canonical SMILES for 10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride is Cl.NCCCCCCCCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride?
The InChIKey is BXFFSTLUGLSRAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H37BrNP.ClH/c29-31(26-18-10-7-11-19-26,27-20-12-8-13-21-27,28-22-14-9-15-23-28)25-17-6-4-2-1-3-5-16-24-30;/h7-15,18-23H,1-6,16-17,24-25,30H2;1H.
What are the key properties of 10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride?
10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride has a molecular weight of 534.95 g/mol, XLogP of 7.33, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[bromo(triphenyl)-λ5-phosphanyl]decan-1-amine;hydrochloride is sourced from PubChem (CID 171509465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).