About 3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine
3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine (PubChem CID 140662780) has the molecular formula C42H46Br2N2P2
and a molecular weight of 800.60 g/mol. Its IUPAC name is 3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine |
| PubChem CID | 140662780 |
| Molecular Formula | C42H46Br2N2P2 |
| Molecular Weight | 800.60 g/mol |
| Exact Mass | 798.15 |
| IUPAC Name | 3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine |
| SMILES | NCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.NCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C21H23BrNP/c2*22-24(18-10-17-23,19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21/h2*1-9,11-16H,10,17-18,23H2 |
| InChIKey | AEBIIJMGMSSNHA-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 800.60 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine?
The IUPAC name of 3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine (CID 140662780) is 3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine.
What is the SMILES notation for 3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine?
The canonical SMILES for 3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine is NCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.NCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine?
The InChIKey is AEBIIJMGMSSNHA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C21H23BrNP/c2*22-24(18-10-17-23,19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21/h2*1-9,11-16H,10,17-18,23H2.
What are the key properties of 3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine?
3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine has a molecular weight of 800.60 g/mol, XLogP of 8.35, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bromo(triphenyl)-λ5-phosphanyl]propan-1-amine is sourced from PubChem (CID 140662780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).