C10H24N10O2 — CID 58517388
2-[2-[2-[2-[[amino-(diaminomethylideneamino)methylidene]amino]ethoxy]ethoxy]ethyl]-1-(diaminomethylidene)guanidine (PubChem CID 58517388) has the molecular formula C10H24N10O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 2-[2-[2-[2-[[amino-(diaminomethylideneamino)methylidene]amino]ethoxy]ethoxy]ethyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[2-[2-[2-[[amino-(diaminomethylideneamino)methylidene]amino]ethoxy]ethoxy]ethyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 58517388 |
| Molecular Formula | C10H24N10O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 2-[2-[2-[2-[[amino-(diaminomethylideneamino)methylidene]amino]ethoxy]ethoxy]ethyl]-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/CCOCCOCC/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C10H24N10O2/c11-7(12)19-9(15)17-1-3-21-5-6-22-4-2-18-10(16)20-8(13)14/h1-6H2,(H6,11,12,15,17,19)(H6,13,14,16,18,20) |
| InChIKey | BPPJMIABMQJBAW-UHFFFAOYSA-N |
| XLogP | -3.80 |
| TPSA | 224.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|