C5H16N4O4S — CID 2794990
2-(4-aminobutyl)guanidine;sulfuric acid (PubChem CID 2794990) has the molecular formula C5H16N4O4S and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-(4-aminobutyl)guanidine;sulfuric acid.
| Compound Name | 2-(4-aminobutyl)guanidine;sulfuric acid |
|---|---|
| PubChem CID | 2794990 |
| Molecular Formula | C5H16N4O4S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-(4-aminobutyl)guanidine;sulfuric acid |
| SMILES | NCCCCN=C(N)N.O=S(=O)(O)O |
| InChI | InChI=1S/C5H14N4.H2O4S/c6-3-1-2-4-9-5(7)8;1-5(2,3)4/h1-4,6H2,(H4,7,8,9);(H2,1,2,3,4) |
| InChIKey | PTAYFGHRDOMJGC-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|