C8H20N4O3S — CID 142675553
[[N'-(6-aminohexyl)carbamimidoyl]amino] methanesulfonate (PubChem CID 142675553) has the molecular formula C8H20N4O3S and a molecular weight of 252.34 g/mol. Its IUPAC name is [[N'-(6-aminohexyl)carbamimidoyl]amino] methanesulfonate.
| Compound Name | [[N'-(6-aminohexyl)carbamimidoyl]amino] methanesulfonate |
|---|---|
| PubChem CID | 142675553 |
| Molecular Formula | C8H20N4O3S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | [[N'-(6-aminohexyl)carbamimidoyl]amino] methanesulfonate |
| SMILES | CS(=O)(=O)ON/C(N)=N/CCCCCCN |
| InChI | InChI=1S/C8H20N4O3S/c1-16(13,14)15-12-8(10)11-7-5-3-2-4-6-9/h2-7,9H2,1H3,(H3,10,11,12) |
| InChIKey | MGHFSPCAOYNOPS-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|