C11H26N4O6 — CID 118238847
2-(4-aminobutyl)guanidine;(3S,4R,5S)-1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 118238847) has the molecular formula C11H26N4O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-(4-aminobutyl)guanidine;(3S,4R,5S)-1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | 2-(4-aminobutyl)guanidine;(3S,4R,5S)-1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 118238847 |
| Molecular Formula | C11H26N4O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-(4-aminobutyl)guanidine;(3S,4R,5S)-1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | NCCCCN=C(N)N.O=C(CO)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H12O6.C5H14N4/c7-1-3(9)5(11)6(12)4(10)2-8;6-3-1-2-4-9-5(7)8/h3,5-9,11-12H,1-2H2;1-4,6H2,(H4,7,8,9)/t3-,5+,6+;/m0./s1 |
| InChIKey | HAYIPGJRYFKZQO-SRIMBOTKSA-N |
| XLogP | -4.38 |
| TPSA | 208.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | -4.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|