C12H26N4O9 — CID 78121986
2-amino-5-(diaminomethylideneamino)pentanoic acid;2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 78121986) has the molecular formula C12H26N4O9 and a molecular weight of 370.36 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 78121986 |
| Molecular Formula | C12H26N4O9 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)O.O=C(O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H14N4O2.C6H12O7/c7-4(5(11)12)2-1-3-10-6(8)9;7-1-2(8)3(9)4(10)5(11)6(12)13/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2-5,7-11H,1H2,(H,12,13) |
| InChIKey | WLKMOAITGHEWQX-UHFFFAOYSA-N |
| XLogP | -5.04 |
| TPSA | 266.17 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | -5.04 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|