About 2-(4-iodobutyl)guanidine
2-(4-iodobutyl)guanidine (PubChem CID 155000477) has the molecular formula C5H12IN3
and a molecular weight of 241.08 g/mol. Its IUPAC name is 2-(4-iodobutyl)guanidine.
Molecular Properties
| Compound Name | 2-(4-iodobutyl)guanidine |
| PubChem CID | 155000477 |
| Molecular Formula | C5H12IN3 |
| Molecular Weight | 241.08 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 2-(4-iodobutyl)guanidine |
| SMILES | NC(N)=NCCCCI |
| InChI | InChI=1S/C5H12IN3/c6-3-1-2-4-9-5(7)8/h1-4H2,(H4,7,8,9) |
| InChIKey | HVCYCMBPVQMSNF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.08 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-iodobutyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-iodobutyl)guanidine?
The IUPAC name of 2-(4-iodobutyl)guanidine (CID 155000477) is 2-(4-iodobutyl)guanidine.
What is the SMILES notation for 2-(4-iodobutyl)guanidine?
The canonical SMILES for 2-(4-iodobutyl)guanidine is NC(N)=NCCCCI.
What is the InChIKey of 2-(4-iodobutyl)guanidine?
The InChIKey is HVCYCMBPVQMSNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12IN3/c6-3-1-2-4-9-5(7)8/h1-4H2,(H4,7,8,9).
What are the key properties of 2-(4-iodobutyl)guanidine?
2-(4-iodobutyl)guanidine has a molecular weight of 241.08 g/mol, XLogP of 0.47, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-iodobutyl)guanidine is sourced from PubChem (CID 155000477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).