About 2-pent-4-ynylguanidine
2-pent-4-ynylguanidine (PubChem CID 103696922) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-pent-4-ynylguanidine.
Molecular Properties
| Compound Name | 2-pent-4-ynylguanidine |
| PubChem CID | 103696922 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 2-pent-4-ynylguanidine |
| SMILES | C#CCCCN=C(N)N |
| InChI | InChI=1S/C6H11N3/c1-2-3-4-5-9-6(7)8/h1H,3-5H2,(H4,7,8,9) |
| InChIKey | OGDDJYMEILMUIY-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-pent-4-ynylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pent-4-ynylguanidine?
The IUPAC name of 2-pent-4-ynylguanidine (CID 103696922) is 2-pent-4-ynylguanidine.
What is the SMILES notation for 2-pent-4-ynylguanidine?
The canonical SMILES for 2-pent-4-ynylguanidine is C#CCCCN=C(N)N.
What is the InChIKey of 2-pent-4-ynylguanidine?
The InChIKey is OGDDJYMEILMUIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-2-3-4-5-9-6(7)8/h1H,3-5H2,(H4,7,8,9).
What are the key properties of 2-pent-4-ynylguanidine?
2-pent-4-ynylguanidine has a molecular weight of 125.17 g/mol, XLogP of -0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pent-4-ynylguanidine is sourced from PubChem (CID 103696922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).