About 2-(aminomethyl)guanidine
2-(aminomethyl)guanidine (PubChem CID 54483546) has the molecular formula C2H8N4
and a molecular weight of 88.11 g/mol. Its IUPAC name is 2-(aminomethyl)guanidine.
Molecular Properties
| Compound Name | 2-(aminomethyl)guanidine |
| PubChem CID | 54483546 |
| Molecular Formula | C2H8N4 |
| Molecular Weight | 88.11 g/mol |
| Exact Mass | 88.07 |
| IUPAC Name | 2-(aminomethyl)guanidine |
| SMILES | NCN=C(N)N |
| InChI | InChI=1S/C2H8N4/c3-1-6-2(4)5/h1,3H2,(H4,4,5,6) |
| InChIKey | XQSGLPYILNSZCF-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.11 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)guanidine?
The IUPAC name of 2-(aminomethyl)guanidine (CID 54483546) is 2-(aminomethyl)guanidine.
What is the SMILES notation for 2-(aminomethyl)guanidine?
The canonical SMILES for 2-(aminomethyl)guanidine is NCN=C(N)N.
What is the InChIKey of 2-(aminomethyl)guanidine?
The InChIKey is XQSGLPYILNSZCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8N4/c3-1-6-2(4)5/h1,3H2,(H4,4,5,6).
What are the key properties of 2-(aminomethyl)guanidine?
2-(aminomethyl)guanidine has a molecular weight of 88.11 g/mol, XLogP of -1.82, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)guanidine is sourced from PubChem (CID 54483546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).