C3H9N3O3 — CID 141191811
2-(diaminomethylideneamino)acetic acid;hydrate (PubChem CID 141191811) has the molecular formula C3H9N3O3 and a molecular weight of 135.12 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)acetic acid;hydrate.
| Compound Name | 2-(diaminomethylideneamino)acetic acid;hydrate |
|---|---|
| PubChem CID | 141191811 |
| Molecular Formula | C3H9N3O3 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.06 |
| IUPAC Name | 2-(diaminomethylideneamino)acetic acid;hydrate |
| SMILES | NC(N)=NCC(=O)O.O |
| InChI | InChI=1S/C3H7N3O2.H2O/c4-3(5)6-1-2(7)8;/h1H2,(H,7,8)(H4,4,5,6);1H2 |
| InChIKey | VSAIOPVIVXABFR-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|